About N-[1-(2,3-dimethyl-4-phenyldiazenylphenyl)naphthalen-2-yl]nitrous amide
N-[1-(2,3-dimethyl-4-phenyldiazenylphenyl)naphthalen-2-yl]nitrous amide (PubChem CID 87711358) has the molecular formula C24H20N4O
and a molecular weight of 380.45 g/mol. Its IUPAC name is N-[1-(2,3-dimethyl-4-phenyldiazenylphenyl)naphthalen-2-yl]nitrous amide.
Molecular Properties
| Compound Name | N-[1-(2,3-dimethyl-4-phenyldiazenylphenyl)naphthalen-2-yl]nitrous amide |
| PubChem CID | 87711358 |
| Molecular Formula | C24H20N4O |
| Molecular Weight | 380.45 g/mol |
| Exact Mass | 380.16 |
| IUPAC Name | N-[1-(2,3-dimethyl-4-phenyldiazenylphenyl)naphthalen-2-yl]nitrous amide |
| SMILES | Cc1c(/N=N/c2ccccc2)ccc(-c2c(NN=O)ccc3ccccc23)c1C |
| InChI | InChI=1S/C24H20N4O/c1-16-17(2)22(26-25-19-9-4-3-5-10-19)15-13-20(16)24-21-11-7-6-8-18(21)12-14-23(24)27-28-29/h3-15H,1-2H3,(H,27,29)/b26-25+ |
| InChIKey | YTXNSHPMEWTOJD-OCEACIFDSA-N |
| XLogP | 7.63 |
| TPSA | 66.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 380.45 |
| LogP ≤ 5 | 7.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-[1-(2,3-dimethyl-4-phenyldiazenylphenyl)naphthalen-2-yl]nitrous amide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[1-(2,3-dimethyl-4-phenyldiazenylphenyl)naphthalen-2-yl]nitrous amide?
The IUPAC name of N-[1-(2,3-dimethyl-4-phenyldiazenylphenyl)naphthalen-2-yl]nitrous amide (CID 87711358) is N-[1-(2,3-dimethyl-4-phenyldiazenylphenyl)naphthalen-2-yl]nitrous amide.
What is the SMILES notation for N-[1-(2,3-dimethyl-4-phenyldiazenylphenyl)naphthalen-2-yl]nitrous amide?
The canonical SMILES for N-[1-(2,3-dimethyl-4-phenyldiazenylphenyl)naphthalen-2-yl]nitrous amide is Cc1c(/N=N/c2ccccc2)ccc(-c2c(NN=O)ccc3ccccc23)c1C.
What is the InChIKey of N-[1-(2,3-dimethyl-4-phenyldiazenylphenyl)naphthalen-2-yl]nitrous amide?
The InChIKey is YTXNSHPMEWTOJD-OCEACIFDSA-N. The full InChI is InChI=1S/C24H20N4O/c1-16-17(2)22(26-25-19-9-4-3-5-10-19)15-13-20(16)24-21-11-7-6-8-18(21)12-14-23(24)27-28-29/h3-15H,1-2H3,(H,27,29)/b26-25+.
What are the key properties of N-[1-(2,3-dimethyl-4-phenyldiazenylphenyl)naphthalen-2-yl]nitrous amide?
N-[1-(2,3-dimethyl-4-phenyldiazenylphenyl)naphthalen-2-yl]nitrous amide has a molecular weight of 380.45 g/mol, XLogP of 7.63, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[1-(2,3-dimethyl-4-phenyldiazenylphenyl)naphthalen-2-yl]nitrous amide is sourced from PubChem (CID 87711358), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).