C20H33BrN2O — CID 87711384
2-(1-cyclohexylpiperazin-1-ium-1-yl)-1-(1,4-dimethylcyclohexa-2,4-dien-1-yl)ethanone bromide (PubChem CID 87711384) has the molecular formula C20H33BrN2O and a molecular weight of 397.40 g/mol. Its IUPAC name is 2-(1-cyclohexylpiperazin-1-ium-1-yl)-1-(1,4-dimethylcyclohexa-2,4-dien-1-yl)ethanone bromide.
| Compound Name | 2-(1-cyclohexylpiperazin-1-ium-1-yl)-1-(1,4-dimethylcyclohexa-2,4-dien-1-yl)ethanone bromide |
|---|---|
| PubChem CID | 87711384 |
| Molecular Formula | C20H33BrN2O |
| Molecular Weight | 397.40 g/mol |
| Exact Mass | 396.18 |
| IUPAC Name | 2-(1-cyclohexylpiperazin-1-ium-1-yl)-1-(1,4-dimethylcyclohexa-2,4-dien-1-yl)ethanone bromide |
| SMILES | CC1=CCC(C)(C(=O)C[N+]2(C3CCCCC3)CCNCC2)C=C1.[Br-] |
| InChI | InChI=1S/C20H33N2O.BrH/c1-17-8-10-20(2,11-9-17)19(23)16-22(14-12-21-13-15-22)18-6-4-3-5-7-18;/h8-10,18,21H,3-7,11-16H2,1-2H3;1H/q+1;/p-1 |
| InChIKey | IKWUKLCPJNLLMX-UHFFFAOYSA-M |
| XLogP | 0.22 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.40 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|