C20H24AsN4O2 — CID 87712170
CID 87712170 (PubChem CID 87712170) has the molecular formula C20H24AsN4O2 and a molecular weight of 427.36 g/mol.
| Compound Name | CID 87712170 |
|---|---|
| PubChem CID | 87712170 |
| Molecular Formula | C20H24AsN4O2 |
| Molecular Weight | 427.36 g/mol |
| Exact Mass | 427.11 |
| IUPAC Name | — |
| SMILES | Cn1nc(C(=O)NC2CN3CCC2CC3)c2ccc([As]C(=O)C3CC3)cc21 |
| InChI | InChI=1S/C20H24AsN4O2/c1-24-17-10-14(21-19(26)13-2-3-13)4-5-15(17)18(23-24)20(27)22-16-11-25-8-6-12(16)7-9-25/h4-5,10,12-13,16H,2-3,6-9,11H2,1H3,(H,22,27) |
| InChIKey | GUOINZHOLIWSHR-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.36 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|