C39H69O4P — CID 87712541
tris(5,7-dimethyl-4-prop-1-en-2-yloct-7-en-3-yl) phosphate (PubChem CID 87712541) has the molecular formula C39H69O4P and a molecular weight of 632.95 g/mol. Its IUPAC name is tris(5,7-dimethyl-4-prop-1-en-2-yloct-7-en-3-yl) phosphate.
| Compound Name | tris(5,7-dimethyl-4-prop-1-en-2-yloct-7-en-3-yl) phosphate |
|---|---|
| PubChem CID | 87712541 |
| Molecular Formula | C39H69O4P |
| Molecular Weight | 632.95 g/mol |
| Exact Mass | 632.49 |
| IUPAC Name | tris(5,7-dimethyl-4-prop-1-en-2-yloct-7-en-3-yl) phosphate |
| SMILES | C=C(C)CC(C)C(C(=C)C)C(CC)OP(=O)(OC(CC)C(C(=C)C)C(C)CC(=C)C)OC(CC)C(C(=C)C)C(C)CC(=C)C |
| InChI | InChI=1S/C39H69O4P/c1-19-34(37(28(10)11)31(16)22-25(4)5)41-44(40,42-35(20-2)38(29(12)13)32(17)23-26(6)7)43-36(21-3)39(30(14)15)33(18)24-27(8)9/h31-39H,4,6,8,10,12,14,19-24H2,1-3,5,7,9,11,13,15-18H3 |
| InChIKey | FMDNYWFQQUSOKN-UHFFFAOYSA-N |
| XLogP | 12.86 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.95 |
| LogP ≤ 5 | 12.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|