C10H13F6NO4 — CID 87713637
2-(butoxycarbonylamino)-4,4,4-trifluoro-3-(trifluoromethyl)butanoic acid (PubChem CID 87713637) has the molecular formula C10H13F6NO4 and a molecular weight of 325.21 g/mol. Its IUPAC name is 2-(butoxycarbonylamino)-4,4,4-trifluoro-3-(trifluoromethyl)butanoic acid.
| Compound Name | 2-(butoxycarbonylamino)-4,4,4-trifluoro-3-(trifluoromethyl)butanoic acid |
|---|---|
| PubChem CID | 87713637 |
| Molecular Formula | C10H13F6NO4 |
| Molecular Weight | 325.21 g/mol |
| Exact Mass | 325.07 |
| IUPAC Name | 2-(butoxycarbonylamino)-4,4,4-trifluoro-3-(trifluoromethyl)butanoic acid |
| SMILES | CCCCOC(=O)NC(C(=O)O)C(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C10H13F6NO4/c1-2-3-4-21-8(20)17-5(7(18)19)6(9(11,12)13)10(14,15)16/h5-6H,2-4H2,1H3,(H,17,20)(H,18,19) |
| InChIKey | UAIYMRPXMCUAER-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.21 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|