C12H9F3N2O7S — CID 87714945
11-hydroxy-10-oxo-3-(trifluoromethylsulfonyloxy)-9,11-diazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carboxylic acid (PubChem CID 87714945) has the molecular formula C12H9F3N2O7S and a molecular weight of 382.27 g/mol. Its IUPAC name is 11-hydroxy-10-oxo-3-(trifluoromethylsulfonyloxy)-9,11-diazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carboxylic acid.
| Compound Name | 11-hydroxy-10-oxo-3-(trifluoromethylsulfonyloxy)-9,11-diazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carboxylic acid |
|---|---|
| PubChem CID | 87714945 |
| Molecular Formula | C12H9F3N2O7S |
| Molecular Weight | 382.27 g/mol |
| Exact Mass | 382.01 |
| IUPAC Name | 11-hydroxy-10-oxo-3-(trifluoromethylsulfonyloxy)-9,11-diazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carboxylic acid |
| SMILES | O=C(O)C1c2cccc(OS(=O)(=O)C(F)(F)F)c2C2CN1C(=O)N2O |
| InChI | InChI=1S/C12H9F3N2O7S/c13-12(14,15)25(22,23)24-7-3-1-2-5-8(7)6-4-16(9(5)10(18)19)11(20)17(6)21/h1-3,6,9,21H,4H2,(H,18,19) |
| InChIKey | WFZCSEGHPGUDEC-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 124.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.27 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|