About 1-bromo-4-chloro-3-(difluoromethyl)-2-fluorobenzene;N-ethyl-N-(trifluoro-λ4-sulfanyl)ethanamine
1-bromo-4-chloro-3-(difluoromethyl)-2-fluorobenzene;N-ethyl-N-(trifluoro-λ4-sulfanyl)ethanamine (PubChem CID 87715053) has the molecular formula C11H13BrClF6NS
and a molecular weight of 420.64 g/mol. Its IUPAC name is 1-bromo-4-chloro-3-(difluoromethyl)-2-fluorobenzene;N-ethyl-N-(trifluoro-λ4-sulfanyl)ethanamine.
Molecular Properties
| Compound Name | 1-bromo-4-chloro-3-(difluoromethyl)-2-fluorobenzene;N-ethyl-N-(trifluoro-λ4-sulfanyl)ethanamine |
| PubChem CID | 87715053 |
| Molecular Formula | C11H13BrClF6NS |
| Molecular Weight | 420.64 g/mol |
| Exact Mass | 418.95 |
| IUPAC Name | 1-bromo-4-chloro-3-(difluoromethyl)-2-fluorobenzene;N-ethyl-N-(trifluoro-λ4-sulfanyl)ethanamine |
| SMILES | CCN(CC)S(F)(F)F.Fc1c(Br)ccc(Cl)c1C(F)F |
| InChI | InChI=1S/C7H3BrClF3.C4H10F3NS/c8-3-1-2-4(9)5(6(3)10)7(11)12;1-3-8(4-2)9(5,6)7/h1-2,7H;3-4H2,1-2H3 |
| InChIKey | GIYDCCVVAMUZSB-UHFFFAOYSA-N |
| XLogP | 6.88 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 420.64 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|
Analyze 1-bromo-4-chloro-3-(difluoromethyl)-2-fluorobenzene;N-ethyl-N-(trifluoro-λ4-sulfanyl)ethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-bromo-4-chloro-3-(difluoromethyl)-2-fluorobenzene;N-ethyl-N-(trifluoro-λ4-sulfanyl)ethanamine?
The IUPAC name of 1-bromo-4-chloro-3-(difluoromethyl)-2-fluorobenzene;N-ethyl-N-(trifluoro-λ4-sulfanyl)ethanamine (CID 87715053) is 1-bromo-4-chloro-3-(difluoromethyl)-2-fluorobenzene;N-ethyl-N-(trifluoro-λ4-sulfanyl)ethanamine.
What is the SMILES notation for 1-bromo-4-chloro-3-(difluoromethyl)-2-fluorobenzene;N-ethyl-N-(trifluoro-λ4-sulfanyl)ethanamine?
The canonical SMILES for 1-bromo-4-chloro-3-(difluoromethyl)-2-fluorobenzene;N-ethyl-N-(trifluoro-λ4-sulfanyl)ethanamine is CCN(CC)S(F)(F)F.Fc1c(Br)ccc(Cl)c1C(F)F.
What is the InChIKey of 1-bromo-4-chloro-3-(difluoromethyl)-2-fluorobenzene;N-ethyl-N-(trifluoro-λ4-sulfanyl)ethanamine?
The InChIKey is GIYDCCVVAMUZSB-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H3BrClF3.C4H10F3NS/c8-3-1-2-4(9)5(6(3)10)7(11)12;1-3-8(4-2)9(5,6)7/h1-2,7H;3-4H2,1-2H3.
What are the key properties of 1-bromo-4-chloro-3-(difluoromethyl)-2-fluorobenzene;N-ethyl-N-(trifluoro-λ4-sulfanyl)ethanamine?
1-bromo-4-chloro-3-(difluoromethyl)-2-fluorobenzene;N-ethyl-N-(trifluoro-λ4-sulfanyl)ethanamine has a molecular weight of 420.64 g/mol, XLogP of 6.88, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-bromo-4-chloro-3-(difluoromethyl)-2-fluorobenzene;N-ethyl-N-(trifluoro-λ4-sulfanyl)ethanamine is sourced from PubChem (CID 87715053), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).