C24H16ClF3N2O5S — CID 87715319
(2,2,2-trifluoroacetyl) 4-amino-3-[[3-[(4-chlorophenyl)methoxy]phenoxy]methyl]thieno[3,2-c]pyridine-7-carboxylate (PubChem CID 87715319) has the molecular formula C24H16ClF3N2O5S and a molecular weight of 536.92 g/mol. Its IUPAC name is (2,2,2-trifluoroacetyl) 4-amino-3-[[3-[(4-chlorophenyl)methoxy]phenoxy]methyl]thieno[3,2-c]pyridine-7-carboxylate.
| Compound Name | (2,2,2-trifluoroacetyl) 4-amino-3-[[3-[(4-chlorophenyl)methoxy]phenoxy]methyl]thieno[3,2-c]pyridine-7-carboxylate |
|---|---|
| PubChem CID | 87715319 |
| Molecular Formula | C24H16ClF3N2O5S |
| Molecular Weight | 536.92 g/mol |
| Exact Mass | 536.04 |
| IUPAC Name | (2,2,2-trifluoroacetyl) 4-amino-3-[[3-[(4-chlorophenyl)methoxy]phenoxy]methyl]thieno[3,2-c]pyridine-7-carboxylate |
| SMILES | Nc1ncc(C(=O)OC(=O)C(F)(F)F)c2scc(COc3cccc(OCc4ccc(Cl)cc4)c3)c12 |
| InChI | InChI=1S/C24H16ClF3N2O5S/c25-15-6-4-13(5-7-15)10-33-16-2-1-3-17(8-16)34-11-14-12-36-20-18(9-30-21(29)19(14)20)22(31)35-23(32)24(26,27)28/h1-9,12H,10-11H2,(H2,29,30) |
| InChIKey | HDGQMPHUHCTWSH-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 100.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.92 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|