About 3-hydroxypropanamide;4-methylbenzenesulfonic acid
3-hydroxypropanamide;4-methylbenzenesulfonic acid (PubChem CID 87716017) has the molecular formula C10H15NO5S
and a molecular weight of 261.30 g/mol. Its IUPAC name is 3-hydroxypropanamide;4-methylbenzenesulfonic acid.
Molecular Properties
| Compound Name | 3-hydroxypropanamide;4-methylbenzenesulfonic acid |
| PubChem CID | 87716017 |
| Molecular Formula | C10H15NO5S |
| Molecular Weight | 261.30 g/mol |
| Exact Mass | 261.07 |
| IUPAC Name | 3-hydroxypropanamide;4-methylbenzenesulfonic acid |
| SMILES | Cc1ccc(S(=O)(=O)O)cc1.NC(=O)CCO |
| InChI | InChI=1S/C7H8O3S.C3H7NO2/c1-6-2-4-7(5-3-6)11(8,9)10;4-3(6)1-2-5/h2-5H,1H3,(H,8,9,10);5H,1-2H2,(H2,4,6) |
| InChIKey | KDYNJKXEYUITHE-UHFFFAOYSA-N |
| XLogP | 0.10 |
| TPSA | 117.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.30 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 3-hydroxypropanamide;4-methylbenzenesulfonic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-hydroxypropanamide;4-methylbenzenesulfonic acid?
The IUPAC name of 3-hydroxypropanamide;4-methylbenzenesulfonic acid (CID 87716017) is 3-hydroxypropanamide;4-methylbenzenesulfonic acid.
What is the SMILES notation for 3-hydroxypropanamide;4-methylbenzenesulfonic acid?
The canonical SMILES for 3-hydroxypropanamide;4-methylbenzenesulfonic acid is Cc1ccc(S(=O)(=O)O)cc1.NC(=O)CCO.
What is the InChIKey of 3-hydroxypropanamide;4-methylbenzenesulfonic acid?
The InChIKey is KDYNJKXEYUITHE-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8O3S.C3H7NO2/c1-6-2-4-7(5-3-6)11(8,9)10;4-3(6)1-2-5/h2-5H,1H3,(H,8,9,10);5H,1-2H2,(H2,4,6).
What are the key properties of 3-hydroxypropanamide;4-methylbenzenesulfonic acid?
3-hydroxypropanamide;4-methylbenzenesulfonic acid has a molecular weight of 261.30 g/mol, XLogP of 0.10, 3 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-hydroxypropanamide;4-methylbenzenesulfonic acid is sourced from PubChem (CID 87716017), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).