About dichloroosmium;3,4-dimethyl-2-pyridin-2-ylpyridine
dichloroosmium;3,4-dimethyl-2-pyridin-2-ylpyridine (PubChem CID 87716395) has the molecular formula C12H12Cl2N2Os
and a molecular weight of 445.38 g/mol. Its IUPAC name is dichloroosmium;3,4-dimethyl-2-pyridin-2-ylpyridine.
Molecular Properties
| Compound Name | dichloroosmium;3,4-dimethyl-2-pyridin-2-ylpyridine |
| PubChem CID | 87716395 |
| Molecular Formula | C12H12Cl2N2Os |
| Molecular Weight | 445.38 g/mol |
| Exact Mass | 446.00 |
| IUPAC Name | dichloroosmium;3,4-dimethyl-2-pyridin-2-ylpyridine |
| SMILES | Cc1ccnc(-c2ccccn2)c1C.Cl[Os]Cl |
| InChI | InChI=1S/C12H12N2.2ClH.Os/c1-9-6-8-14-12(10(9)2)11-5-3-4-7-13-11;;;/h3-8H,1-2H3;2*1H;/q;;;+2/p-2 |
| InChIKey | CEZPOMWMTIXSHL-UHFFFAOYSA-L |
| XLogP | 4.14 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 445.38 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze dichloroosmium;3,4-dimethyl-2-pyridin-2-ylpyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dichloroosmium;3,4-dimethyl-2-pyridin-2-ylpyridine?
The IUPAC name of dichloroosmium;3,4-dimethyl-2-pyridin-2-ylpyridine (CID 87716395) is dichloroosmium;3,4-dimethyl-2-pyridin-2-ylpyridine.
What is the SMILES notation for dichloroosmium;3,4-dimethyl-2-pyridin-2-ylpyridine?
The canonical SMILES for dichloroosmium;3,4-dimethyl-2-pyridin-2-ylpyridine is Cc1ccnc(-c2ccccn2)c1C.Cl[Os]Cl.
What is the InChIKey of dichloroosmium;3,4-dimethyl-2-pyridin-2-ylpyridine?
The InChIKey is CEZPOMWMTIXSHL-UHFFFAOYSA-L. The full InChI is InChI=1S/C12H12N2.2ClH.Os/c1-9-6-8-14-12(10(9)2)11-5-3-4-7-13-11;;;/h3-8H,1-2H3;2*1H;/q;;;+2/p-2.
What are the key properties of dichloroosmium;3,4-dimethyl-2-pyridin-2-ylpyridine?
dichloroosmium;3,4-dimethyl-2-pyridin-2-ylpyridine has a molecular weight of 445.38 g/mol, XLogP of 4.14, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for dichloroosmium;3,4-dimethyl-2-pyridin-2-ylpyridine is sourced from PubChem (CID 87716395), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).