C25H14ClF5N4O3S — CID 87716997
6-(2-chlorophenyl)-2-(difluoromethyl)-N-[(3S)-2,4-dioxothiolan-3-yl]-7-[4-(trifluoromethyl)phenyl]pyrazolo[1,5-a]pyrimidine-3-carboxamide (PubChem CID 87716997) has the molecular formula C25H14ClF5N4O3S and a molecular weight of 580.92 g/mol. Its IUPAC name is 6-(2-chlorophenyl)-2-(difluoromethyl)-N-[(3S)-2,4-dioxothiolan-3-yl]-7-[4-(trifluoromethyl)phenyl]pyrazolo[1,5-a]pyrimidine-3-carboxamide.
| Compound Name | 6-(2-chlorophenyl)-2-(difluoromethyl)-N-[(3S)-2,4-dioxothiolan-3-yl]-7-[4-(trifluoromethyl)phenyl]pyrazolo[1,5-a]pyrimidine-3-carboxamide |
|---|---|
| PubChem CID | 87716997 |
| Molecular Formula | C25H14ClF5N4O3S |
| Molecular Weight | 580.92 g/mol |
| Exact Mass | 580.04 |
| IUPAC Name | 6-(2-chlorophenyl)-2-(difluoromethyl)-N-[(3S)-2,4-dioxothiolan-3-yl]-7-[4-(trifluoromethyl)phenyl]pyrazolo[1,5-a]pyrimidine-3-carboxamide |
| SMILES | O=C(N[C@H]1C(=O)CSC1=O)c1c(C(F)F)nn2c(-c3ccc(C(F)(F)F)cc3)c(-c3ccccc3Cl)cnc12 |
| InChI | InChI=1S/C25H14ClF5N4O3S/c26-15-4-2-1-3-13(15)14-9-32-22-17(23(37)33-18-16(36)10-39-24(18)38)19(21(27)28)34-35(22)20(14)11-5-7-12(8-6-11)25(29,30)31/h1-9,18,21H,10H2,(H,33,37)/t18-/m0/s1 |
| InChIKey | PEIQDYSMZHUCNX-SFHVURJKSA-N |
| XLogP | 5.61 |
| TPSA | 93.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.92 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|