C22H14N2O4 — CID 87716999
4-(5,9-dioxo-1,2,3,4-tetrahydroisochromeno[4,3-g][1,4]benzoxazin-10-yl)benzonitrile (PubChem CID 87716999) has the molecular formula C22H14N2O4 and a molecular weight of 370.36 g/mol. Its IUPAC name is 4-(5,9-dioxo-1,2,3,4-tetrahydroisochromeno[4,3-g][1,4]benzoxazin-10-yl)benzonitrile.
| Compound Name | 4-(5,9-dioxo-1,2,3,4-tetrahydroisochromeno[4,3-g][1,4]benzoxazin-10-yl)benzonitrile |
|---|---|
| PubChem CID | 87716999 |
| Molecular Formula | C22H14N2O4 |
| Molecular Weight | 370.36 g/mol |
| Exact Mass | 370.10 |
| IUPAC Name | 4-(5,9-dioxo-1,2,3,4-tetrahydroisochromeno[4,3-g][1,4]benzoxazin-10-yl)benzonitrile |
| SMILES | N#Cc1ccc(-c2nc3cc4c5c(c(=O)oc4cc3oc2=O)CCCC5)cc1 |
| InChI | InChI=1S/C22H14N2O4/c23-11-12-5-7-13(8-6-12)20-22(26)28-19-10-18-16(9-17(19)24-20)14-3-1-2-4-15(14)21(25)27-18/h5-10H,1-4H2 |
| InChIKey | MCFINZGIQHSHNU-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 97.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.36 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|