C22H16F3N5O3 — CID 87717127
(2,2,2-trifluoroacetyl) 1-(2-aminoethyl)-3-(2-quinolin-3-yl-4-pyridinyl)pyrazole-5-carboxylate (PubChem CID 87717127) has the molecular formula C22H16F3N5O3 and a molecular weight of 455.40 g/mol. Its IUPAC name is (2,2,2-trifluoroacetyl) 1-(2-aminoethyl)-3-(2-quinolin-3-yl-4-pyridinyl)pyrazole-5-carboxylate.
| Compound Name | (2,2,2-trifluoroacetyl) 1-(2-aminoethyl)-3-(2-quinolin-3-yl-4-pyridinyl)pyrazole-5-carboxylate |
|---|---|
| PubChem CID | 87717127 |
| Molecular Formula | C22H16F3N5O3 |
| Molecular Weight | 455.40 g/mol |
| Exact Mass | 455.12 |
| IUPAC Name | (2,2,2-trifluoroacetyl) 1-(2-aminoethyl)-3-(2-quinolin-3-yl-4-pyridinyl)pyrazole-5-carboxylate |
| SMILES | NCCn1nc(-c2ccnc(-c3cnc4ccccc4c3)c2)cc1C(=O)OC(=O)C(F)(F)F |
| InChI | InChI=1S/C22H16F3N5O3/c23-22(24,25)21(32)33-20(31)19-11-18(29-30(19)8-6-26)14-5-7-27-17(10-14)15-9-13-3-1-2-4-16(13)28-12-15/h1-5,7,9-12H,6,8,26H2 |
| InChIKey | BCPNMCDIVWWGTD-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 112.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.40 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|