About ethyl 2-methylprop-2-enoate;2-methylbuta-1,3-diene
ethyl 2-methylprop-2-enoate;2-methylbuta-1,3-diene (PubChem CID 87717143) has the molecular formula C11H18O2
and a molecular weight of 182.26 g/mol. Its IUPAC name is ethyl 2-methylprop-2-enoate;2-methylbuta-1,3-diene.
Molecular Properties
| Compound Name | ethyl 2-methylprop-2-enoate;2-methylbuta-1,3-diene |
| PubChem CID | 87717143 |
| Molecular Formula | C11H18O2 |
| Molecular Weight | 182.26 g/mol |
| Exact Mass | 182.13 |
| IUPAC Name | ethyl 2-methylprop-2-enoate;2-methylbuta-1,3-diene |
| SMILES | C=C(C)C(=O)OCC.C=CC(=C)C |
| InChI | InChI=1S/C6H10O2.C5H8/c1-4-8-6(7)5(2)3;1-4-5(2)3/h2,4H2,1,3H3;4H,1-2H2,3H3 |
| InChIKey | RXQXUXZUWNFWJV-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.26 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze ethyl 2-methylprop-2-enoate;2-methylbuta-1,3-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-methylprop-2-enoate;2-methylbuta-1,3-diene?
The IUPAC name of ethyl 2-methylprop-2-enoate;2-methylbuta-1,3-diene (CID 87717143) is ethyl 2-methylprop-2-enoate;2-methylbuta-1,3-diene.
What is the SMILES notation for ethyl 2-methylprop-2-enoate;2-methylbuta-1,3-diene?
The canonical SMILES for ethyl 2-methylprop-2-enoate;2-methylbuta-1,3-diene is C=C(C)C(=O)OCC.C=CC(=C)C.
What is the InChIKey of ethyl 2-methylprop-2-enoate;2-methylbuta-1,3-diene?
The InChIKey is RXQXUXZUWNFWJV-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10O2.C5H8/c1-4-8-6(7)5(2)3;1-4-5(2)3/h2,4H2,1,3H3;4H,1-2H2,3H3.
What are the key properties of ethyl 2-methylprop-2-enoate;2-methylbuta-1,3-diene?
ethyl 2-methylprop-2-enoate;2-methylbuta-1,3-diene has a molecular weight of 182.26 g/mol, XLogP of 2.87, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-methylprop-2-enoate;2-methylbuta-1,3-diene is sourced from PubChem (CID 87717143), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).