C17H17ClN2O2 — CID 87717650
(2S,3S)-3-(5-chloro-7-methylpyrrolo[2,3-c]pyridin-1-yl)-3-phenylpropane-1,2-diol (PubChem CID 87717650) has the molecular formula C17H17ClN2O2 and a molecular weight of 316.79 g/mol. Its IUPAC name is (2S,3S)-3-(5-chloro-7-methylpyrrolo[2,3-c]pyridin-1-yl)-3-phenylpropane-1,2-diol.
| Compound Name | (2S,3S)-3-(5-chloro-7-methylpyrrolo[2,3-c]pyridin-1-yl)-3-phenylpropane-1,2-diol |
|---|---|
| PubChem CID | 87717650 |
| Molecular Formula | C17H17ClN2O2 |
| Molecular Weight | 316.79 g/mol |
| Exact Mass | 316.10 |
| IUPAC Name | (2S,3S)-3-(5-chloro-7-methylpyrrolo[2,3-c]pyridin-1-yl)-3-phenylpropane-1,2-diol |
| SMILES | Cc1nc(Cl)cc2ccn([C@@H](c3ccccc3)[C@H](O)CO)c12 |
| InChI | InChI=1S/C17H17ClN2O2/c1-11-16-13(9-15(18)19-11)7-8-20(16)17(14(22)10-21)12-5-3-2-4-6-12/h2-9,14,17,21-22H,10H2,1H3/t14-,17+/m1/s1 |
| InChIKey | CHDLSZXUJGMFBR-PBHICJAKSA-N |
| XLogP | 2.94 |
| TPSA | 58.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.79 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|