C31H29NO5S — CID 87717669
[2-hydroxy-3-phenyl-3-(7-phenylmethoxyindol-1-yl)propyl] 4-methylbenzenesulfonate (PubChem CID 87717669) has the molecular formula C31H29NO5S and a molecular weight of 527.64 g/mol. Its IUPAC name is [2-hydroxy-3-phenyl-3-(7-phenylmethoxyindol-1-yl)propyl] 4-methylbenzenesulfonate.
| Compound Name | [2-hydroxy-3-phenyl-3-(7-phenylmethoxyindol-1-yl)propyl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 87717669 |
| Molecular Formula | C31H29NO5S |
| Molecular Weight | 527.64 g/mol |
| Exact Mass | 527.18 |
| IUPAC Name | [2-hydroxy-3-phenyl-3-(7-phenylmethoxyindol-1-yl)propyl] 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OCC(O)C(c2ccccc2)n2ccc3cccc(OCc4ccccc4)c32)cc1 |
| InChI | InChI=1S/C31H29NO5S/c1-23-15-17-27(18-16-23)38(34,35)37-22-28(33)30(25-11-6-3-7-12-25)32-20-19-26-13-8-14-29(31(26)32)36-21-24-9-4-2-5-10-24/h2-20,28,30,33H,21-22H2,1H3 |
| InChIKey | NWBYKBKTKVURAN-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.64 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|