About 2-anthracen-1-yl-1,3,5-triazine
2-anthracen-1-yl-1,3,5-triazine (PubChem CID 87717818) has the molecular formula C17H11N3
and a molecular weight of 257.30 g/mol. Its IUPAC name is 2-anthracen-1-yl-1,3,5-triazine.
Molecular Properties
| Compound Name | 2-anthracen-1-yl-1,3,5-triazine |
| PubChem CID | 87717818 |
| Molecular Formula | C17H11N3 |
| Molecular Weight | 257.30 g/mol |
| Exact Mass | 257.10 |
| IUPAC Name | 2-anthracen-1-yl-1,3,5-triazine |
| SMILES | c1ccc2cc3c(-c4ncncn4)cccc3cc2c1 |
| InChI | InChI=1S/C17H11N3/c1-2-5-13-9-16-14(8-12(13)4-1)6-3-7-15(16)17-19-10-18-11-20-17/h1-11H |
| InChIKey | ZPOJVAKTYVFNEL-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.30 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze 2-anthracen-1-yl-1,3,5-triazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-anthracen-1-yl-1,3,5-triazine?
The IUPAC name of 2-anthracen-1-yl-1,3,5-triazine (CID 87717818) is 2-anthracen-1-yl-1,3,5-triazine.
What is the SMILES notation for 2-anthracen-1-yl-1,3,5-triazine?
The canonical SMILES for 2-anthracen-1-yl-1,3,5-triazine is c1ccc2cc3c(-c4ncncn4)cccc3cc2c1.
What is the InChIKey of 2-anthracen-1-yl-1,3,5-triazine?
The InChIKey is ZPOJVAKTYVFNEL-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H11N3/c1-2-5-13-9-16-14(8-12(13)4-1)6-3-7-15(16)17-19-10-18-11-20-17/h1-11H.
What are the key properties of 2-anthracen-1-yl-1,3,5-triazine?
2-anthracen-1-yl-1,3,5-triazine has a molecular weight of 257.30 g/mol, XLogP of 3.85, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-anthracen-1-yl-1,3,5-triazine is sourced from PubChem (CID 87717818), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).