About 3-[(2,2-difluoro-2-iodoacetyl)amino]-2-(3-hydroxy-6-oxoxanthen-9-yl)benzoic acid
3-[(2,2-difluoro-2-iodoacetyl)amino]-2-(3-hydroxy-6-oxoxanthen-9-yl)benzoic acid (PubChem CID 87718817) has the molecular formula C22H12F2INO6
and a molecular weight of 551.24 g/mol. Its IUPAC name is 3-[(2,2-difluoro-2-iodoacetyl)amino]-2-(3-hydroxy-6-oxoxanthen-9-yl)benzoic acid.
Molecular Properties
| Compound Name | 3-[(2,2-difluoro-2-iodoacetyl)amino]-2-(3-hydroxy-6-oxoxanthen-9-yl)benzoic acid |
| PubChem CID | 87718817 |
| Molecular Formula | C22H12F2INO6 |
| Molecular Weight | 551.24 g/mol |
| Exact Mass | 550.97 |
| IUPAC Name | 3-[(2,2-difluoro-2-iodoacetyl)amino]-2-(3-hydroxy-6-oxoxanthen-9-yl)benzoic acid |
| SMILES | O=C(O)c1cccc(NC(=O)C(F)(F)I)c1-c1c2ccc(=O)cc-2oc2cc(O)ccc12 |
| InChI | InChI=1S/C22H12F2INO6/c23-22(24,25)21(31)26-15-3-1-2-14(20(29)30)19(15)18-12-6-4-10(27)8-16(12)32-17-9-11(28)5-7-13(17)18/h1-9,27H,(H,26,31)(H,29,30) |
| InChIKey | OFQLROQYJMBCQG-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 116.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 551.24 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze 3-[(2,2-difluoro-2-iodoacetyl)amino]-2-(3-hydroxy-6-oxoxanthen-9-yl)benzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(2,2-difluoro-2-iodoacetyl)amino]-2-(3-hydroxy-6-oxoxanthen-9-yl)benzoic acid?
The IUPAC name of 3-[(2,2-difluoro-2-iodoacetyl)amino]-2-(3-hydroxy-6-oxoxanthen-9-yl)benzoic acid (CID 87718817) is 3-[(2,2-difluoro-2-iodoacetyl)amino]-2-(3-hydroxy-6-oxoxanthen-9-yl)benzoic acid.
What is the SMILES notation for 3-[(2,2-difluoro-2-iodoacetyl)amino]-2-(3-hydroxy-6-oxoxanthen-9-yl)benzoic acid?
The canonical SMILES for 3-[(2,2-difluoro-2-iodoacetyl)amino]-2-(3-hydroxy-6-oxoxanthen-9-yl)benzoic acid is O=C(O)c1cccc(NC(=O)C(F)(F)I)c1-c1c2ccc(=O)cc-2oc2cc(O)ccc12.
What is the InChIKey of 3-[(2,2-difluoro-2-iodoacetyl)amino]-2-(3-hydroxy-6-oxoxanthen-9-yl)benzoic acid?
The InChIKey is OFQLROQYJMBCQG-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H12F2INO6/c23-22(24,25)21(31)26-15-3-1-2-14(20(29)30)19(15)18-12-6-4-10(27)8-16(12)32-17-9-11(28)5-7-13(17)18/h1-9,27H,(H,26,31)(H,29,30).
What are the key properties of 3-[(2,2-difluoro-2-iodoacetyl)amino]-2-(3-hydroxy-6-oxoxanthen-9-yl)benzoic acid?
3-[(2,2-difluoro-2-iodoacetyl)amino]-2-(3-hydroxy-6-oxoxanthen-9-yl)benzoic acid has a molecular weight of 551.24 g/mol, XLogP of 4.93, 4 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(2,2-difluoro-2-iodoacetyl)amino]-2-(3-hydroxy-6-oxoxanthen-9-yl)benzoic acid is sourced from PubChem (CID 87718817), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).