C14H26F5NS — CID 87718845
9-(4,4,5,5,5-pentafluoropentylsulfanyl)nonan-1-amine (PubChem CID 87718845) has the molecular formula C14H26F5NS and a molecular weight of 335.43 g/mol. Its IUPAC name is 9-(4,4,5,5,5-pentafluoropentylsulfanyl)nonan-1-amine.
| Compound Name | 9-(4,4,5,5,5-pentafluoropentylsulfanyl)nonan-1-amine |
|---|---|
| PubChem CID | 87718845 |
| Molecular Formula | C14H26F5NS |
| Molecular Weight | 335.43 g/mol |
| Exact Mass | 335.17 |
| IUPAC Name | 9-(4,4,5,5,5-pentafluoropentylsulfanyl)nonan-1-amine |
| SMILES | NCCCCCCCCCSCCCC(F)(F)C(F)(F)F |
| InChI | InChI=1S/C14H26F5NS/c15-13(16,14(17,18)19)9-8-12-21-11-7-5-3-1-2-4-6-10-20/h1-12,20H2 |
| InChIKey | LAJPSHMOOFOKIM-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.43 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|