About bromocyclopentane;1-bromo-2,5-diethylcyclopenta-1,3-diene;iron
bromocyclopentane;1-bromo-2,5-diethylcyclopenta-1,3-diene;iron (PubChem CID 87718885) has the molecular formula C14H16Br2Fe-6
and a molecular weight of 399.94 g/mol. Its IUPAC name is bromocyclopentane;1-bromo-2,5-diethylcyclopenta-1,3-diene;iron.
Molecular Properties
| Compound Name | bromocyclopentane;1-bromo-2,5-diethylcyclopenta-1,3-diene;iron |
| PubChem CID | 87718885 |
| Molecular Formula | C14H16Br2Fe-6 |
| Molecular Weight | 399.94 g/mol |
| Exact Mass | 397.90 |
| IUPAC Name | bromocyclopentane;1-bromo-2,5-diethylcyclopenta-1,3-diene;iron |
| SMILES | Br[c-]1[cH-][cH-][cH-][cH-]1.CCc1cc[c-](CC)c1Br.[Fe] |
| InChI | InChI=1S/C9H12Br.C5H4Br.Fe/c1-3-7-5-6-8(4-2)9(7)10;6-5-3-1-2-4-5;/h5-6H,3-4H2,1-2H3;1-4H;/q-1;-5; |
| InChIKey | AUIWCYYMFDHYIG-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 399.94 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze bromocyclopentane;1-bromo-2,5-diethylcyclopenta-1,3-diene;iron with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bromocyclopentane;1-bromo-2,5-diethylcyclopenta-1,3-diene;iron?
The IUPAC name of bromocyclopentane;1-bromo-2,5-diethylcyclopenta-1,3-diene;iron (CID 87718885) is bromocyclopentane;1-bromo-2,5-diethylcyclopenta-1,3-diene;iron.
What is the SMILES notation for bromocyclopentane;1-bromo-2,5-diethylcyclopenta-1,3-diene;iron?
The canonical SMILES for bromocyclopentane;1-bromo-2,5-diethylcyclopenta-1,3-diene;iron is Br[c-]1[cH-][cH-][cH-][cH-]1.CCc1cc[c-](CC)c1Br.[Fe].
What is the InChIKey of bromocyclopentane;1-bromo-2,5-diethylcyclopenta-1,3-diene;iron?
The InChIKey is AUIWCYYMFDHYIG-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12Br.C5H4Br.Fe/c1-3-7-5-6-8(4-2)9(7)10;6-5-3-1-2-4-5;/h5-6H,3-4H2,1-2H3;1-4H;/q-1;-5;.
What are the key properties of bromocyclopentane;1-bromo-2,5-diethylcyclopenta-1,3-diene;iron?
bromocyclopentane;1-bromo-2,5-diethylcyclopenta-1,3-diene;iron has a molecular weight of 399.94 g/mol, XLogP of 5.46, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for bromocyclopentane;1-bromo-2,5-diethylcyclopenta-1,3-diene;iron is sourced from PubChem (CID 87718885), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).