About 2-diphenylphosphanyl-N,N-bis(trimethylsilyl)aniline
2-diphenylphosphanyl-N,N-bis(trimethylsilyl)aniline (PubChem CID 87719008) has the molecular formula C24H32NPSi2
and a molecular weight of 421.67 g/mol. Its IUPAC name is 2-diphenylphosphanyl-N,N-bis(trimethylsilyl)aniline.
Molecular Properties
| Compound Name | 2-diphenylphosphanyl-N,N-bis(trimethylsilyl)aniline |
| PubChem CID | 87719008 |
| Molecular Formula | C24H32NPSi2 |
| Molecular Weight | 421.67 g/mol |
| Exact Mass | 421.18 |
| IUPAC Name | 2-diphenylphosphanyl-N,N-bis(trimethylsilyl)aniline |
| SMILES | C[Si](C)(C)N(c1ccccc1P(c1ccccc1)c1ccccc1)[Si](C)(C)C |
| InChI | InChI=1S/C24H32NPSi2/c1-27(2,3)25(28(4,5)6)23-19-13-14-20-24(23)26(21-15-9-7-10-16-21)22-17-11-8-12-18-22/h7-20H,1-6H3 |
| InChIKey | CNYIVOOOSMKGHD-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 421.67 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 2-diphenylphosphanyl-N,N-bis(trimethylsilyl)aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-diphenylphosphanyl-N,N-bis(trimethylsilyl)aniline?
The IUPAC name of 2-diphenylphosphanyl-N,N-bis(trimethylsilyl)aniline (CID 87719008) is 2-diphenylphosphanyl-N,N-bis(trimethylsilyl)aniline.
What is the SMILES notation for 2-diphenylphosphanyl-N,N-bis(trimethylsilyl)aniline?
The canonical SMILES for 2-diphenylphosphanyl-N,N-bis(trimethylsilyl)aniline is C[Si](C)(C)N(c1ccccc1P(c1ccccc1)c1ccccc1)[Si](C)(C)C.
What is the InChIKey of 2-diphenylphosphanyl-N,N-bis(trimethylsilyl)aniline?
The InChIKey is CNYIVOOOSMKGHD-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H32NPSi2/c1-27(2,3)25(28(4,5)6)23-19-13-14-20-24(23)26(21-15-9-7-10-16-21)22-17-11-8-12-18-22/h7-20H,1-6H3.
What are the key properties of 2-diphenylphosphanyl-N,N-bis(trimethylsilyl)aniline?
2-diphenylphosphanyl-N,N-bis(trimethylsilyl)aniline has a molecular weight of 421.67 g/mol, XLogP of 5.92, 6 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-diphenylphosphanyl-N,N-bis(trimethylsilyl)aniline is sourced from PubChem (CID 87719008), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).