C27H30F6N2O5 — CID 87719518
N-[[2-ethoxy-5-[4-(2,2,2-trifluoroacetyl)phenyl]phenyl]methyl]-4-(methylamino)cyclohexane-1-carboxamide;2,2,2-trifluoroacetic acid (PubChem CID 87719518) has the molecular formula C27H30F6N2O5 and a molecular weight of 576.53 g/mol. Its IUPAC name is N-[[2-ethoxy-5-[4-(2,2,2-trifluoroacetyl)phenyl]phenyl]methyl]-4-(methylamino)cyclohexane-1-carboxamide;2,2,2-trifluoroacetic acid.
| Compound Name | N-[[2-ethoxy-5-[4-(2,2,2-trifluoroacetyl)phenyl]phenyl]methyl]-4-(methylamino)cyclohexane-1-carboxamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 87719518 |
| Molecular Formula | C27H30F6N2O5 |
| Molecular Weight | 576.53 g/mol |
| Exact Mass | 576.21 |
| IUPAC Name | N-[[2-ethoxy-5-[4-(2,2,2-trifluoroacetyl)phenyl]phenyl]methyl]-4-(methylamino)cyclohexane-1-carboxamide;2,2,2-trifluoroacetic acid |
| SMILES | CCOc1ccc(-c2ccc(C(=O)C(F)(F)F)cc2)cc1CNC(=O)C1CCC(NC)CC1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C25H29F3N2O3.C2HF3O2/c1-3-33-22-13-10-19(16-4-6-17(7-5-16)23(31)25(26,27)28)14-20(22)15-30-24(32)18-8-11-21(29-2)12-9-18;3-2(4,5)1(6)7/h4-7,10,13-14,18,21,29H,3,8-9,11-12,15H2,1-2H3,(H,30,32);(H,6,7) |
| InChIKey | CLDNZMGCTVPPPF-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.53 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |