C15H28F5NS — CID 87719547
N-methyl-9-(4,4,5,5,5-pentafluoropentylsulfanyl)nonan-1-amine (PubChem CID 87719547) has the molecular formula C15H28F5NS and a molecular weight of 349.45 g/mol. Its IUPAC name is N-methyl-9-(4,4,5,5,5-pentafluoropentylsulfanyl)nonan-1-amine.
| Compound Name | N-methyl-9-(4,4,5,5,5-pentafluoropentylsulfanyl)nonan-1-amine |
|---|---|
| PubChem CID | 87719547 |
| Molecular Formula | C15H28F5NS |
| Molecular Weight | 349.45 g/mol |
| Exact Mass | 349.19 |
| IUPAC Name | N-methyl-9-(4,4,5,5,5-pentafluoropentylsulfanyl)nonan-1-amine |
| SMILES | CNCCCCCCCCCSCCCC(F)(F)C(F)(F)F |
| InChI | InChI=1S/C15H28F5NS/c1-21-11-7-5-3-2-4-6-8-12-22-13-9-10-14(16,17)15(18,19)20/h21H,2-13H2,1H3 |
| InChIKey | JPNMLHDRYQMFGW-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.45 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|