C13H17F5N2O3S2 — CID 87719816
4-methylbenzenesulfonic acid;4,4,5,5,5-pentafluoropentylthiourea (PubChem CID 87719816) has the molecular formula C13H17F5N2O3S2 and a molecular weight of 408.41 g/mol. Its IUPAC name is 4-methylbenzenesulfonic acid;4,4,5,5,5-pentafluoropentylthiourea.
| Compound Name | 4-methylbenzenesulfonic acid;4,4,5,5,5-pentafluoropentylthiourea |
|---|---|
| PubChem CID | 87719816 |
| Molecular Formula | C13H17F5N2O3S2 |
| Molecular Weight | 408.41 g/mol |
| Exact Mass | 408.06 |
| IUPAC Name | 4-methylbenzenesulfonic acid;4,4,5,5,5-pentafluoropentylthiourea |
| SMILES | Cc1ccc(S(=O)(=O)O)cc1.NC(=S)NCCCC(F)(F)C(F)(F)F |
| InChI | InChI=1S/C7H8O3S.C6H9F5N2S/c1-6-2-4-7(5-3-6)11(8,9)10;7-5(8,6(9,10)11)2-1-3-13-4(12)14/h2-5H,1H3,(H,8,9,10);1-3H2,(H3,12,13,14) |
| InChIKey | OWMRTNZQAGGTRJ-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.41 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|