About [4-(1-methyl-2-pyridin-3-ylpyrrolo[3,2-b]pyridin-3-yl)phenyl] trifluoromethanesulfonate
[4-(1-methyl-2-pyridin-3-ylpyrrolo[3,2-b]pyridin-3-yl)phenyl] trifluoromethanesulfonate (PubChem CID 87719945) has the molecular formula C20H14F3N3O3S
and a molecular weight of 433.41 g/mol. Its IUPAC name is [4-(1-methyl-2-pyridin-3-ylpyrrolo[3,2-b]pyridin-3-yl)phenyl] trifluoromethanesulfonate.
Molecular Properties
| Compound Name | [4-(1-methyl-2-pyridin-3-ylpyrrolo[3,2-b]pyridin-3-yl)phenyl] trifluoromethanesulfonate |
| PubChem CID | 87719945 |
| Molecular Formula | C20H14F3N3O3S |
| Molecular Weight | 433.41 g/mol |
| Exact Mass | 433.07 |
| IUPAC Name | [4-(1-methyl-2-pyridin-3-ylpyrrolo[3,2-b]pyridin-3-yl)phenyl] trifluoromethanesulfonate |
| SMILES | Cn1c(-c2cccnc2)c(-c2ccc(OS(=O)(=O)C(F)(F)F)cc2)c2ncccc21 |
| InChI | InChI=1S/C20H14F3N3O3S/c1-26-16-5-3-11-25-18(16)17(19(26)14-4-2-10-24-12-14)13-6-8-15(9-7-13)29-30(27,28)20(21,22)23/h2-12H,1H3 |
| InChIKey | JAUDOOFPPAXYAO-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 74.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 433.41 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|
Analyze [4-(1-methyl-2-pyridin-3-ylpyrrolo[3,2-b]pyridin-3-yl)phenyl] trifluoromethanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(1-methyl-2-pyridin-3-ylpyrrolo[3,2-b]pyridin-3-yl)phenyl] trifluoromethanesulfonate?
The IUPAC name of [4-(1-methyl-2-pyridin-3-ylpyrrolo[3,2-b]pyridin-3-yl)phenyl] trifluoromethanesulfonate (CID 87719945) is [4-(1-methyl-2-pyridin-3-ylpyrrolo[3,2-b]pyridin-3-yl)phenyl] trifluoromethanesulfonate.
What is the SMILES notation for [4-(1-methyl-2-pyridin-3-ylpyrrolo[3,2-b]pyridin-3-yl)phenyl] trifluoromethanesulfonate?
The canonical SMILES for [4-(1-methyl-2-pyridin-3-ylpyrrolo[3,2-b]pyridin-3-yl)phenyl] trifluoromethanesulfonate is Cn1c(-c2cccnc2)c(-c2ccc(OS(=O)(=O)C(F)(F)F)cc2)c2ncccc21.
What is the InChIKey of [4-(1-methyl-2-pyridin-3-ylpyrrolo[3,2-b]pyridin-3-yl)phenyl] trifluoromethanesulfonate?
The InChIKey is JAUDOOFPPAXYAO-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H14F3N3O3S/c1-26-16-5-3-11-25-18(16)17(19(26)14-4-2-10-24-12-14)13-6-8-15(9-7-13)29-30(27,28)20(21,22)23/h2-12H,1H3.
What are the key properties of [4-(1-methyl-2-pyridin-3-ylpyrrolo[3,2-b]pyridin-3-yl)phenyl] trifluoromethanesulfonate?
[4-(1-methyl-2-pyridin-3-ylpyrrolo[3,2-b]pyridin-3-yl)phenyl] trifluoromethanesulfonate has a molecular weight of 433.41 g/mol, XLogP of 4.53, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(1-methyl-2-pyridin-3-ylpyrrolo[3,2-b]pyridin-3-yl)phenyl] trifluoromethanesulfonate is sourced from PubChem (CID 87719945), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).