About 2-[3,5-bis(2,2-dimethylpropoxy)phenyl]acetaldehyde
2-[3,5-bis(2,2-dimethylpropoxy)phenyl]acetaldehyde (PubChem CID 87720248) has the molecular formula C18H28O3
and a molecular weight of 292.42 g/mol. Its IUPAC name is 2-[3,5-bis(2,2-dimethylpropoxy)phenyl]acetaldehyde.
Molecular Properties
| Compound Name | 2-[3,5-bis(2,2-dimethylpropoxy)phenyl]acetaldehyde |
| PubChem CID | 87720248 |
| Molecular Formula | C18H28O3 |
| Molecular Weight | 292.42 g/mol |
| Exact Mass | 292.20 |
| IUPAC Name | 2-[3,5-bis(2,2-dimethylpropoxy)phenyl]acetaldehyde |
| SMILES | CC(C)(C)COc1cc(CC=O)cc(OCC(C)(C)C)c1 |
| InChI | InChI=1S/C18H28O3/c1-17(2,3)12-20-15-9-14(7-8-19)10-16(11-15)21-13-18(4,5)6/h8-11H,7,12-13H2,1-6H3 |
| InChIKey | FGDHWDTXCOXCCI-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 292.42 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 2-[3,5-bis(2,2-dimethylpropoxy)phenyl]acetaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[3,5-bis(2,2-dimethylpropoxy)phenyl]acetaldehyde?
The IUPAC name of 2-[3,5-bis(2,2-dimethylpropoxy)phenyl]acetaldehyde (CID 87720248) is 2-[3,5-bis(2,2-dimethylpropoxy)phenyl]acetaldehyde.
What is the SMILES notation for 2-[3,5-bis(2,2-dimethylpropoxy)phenyl]acetaldehyde?
The canonical SMILES for 2-[3,5-bis(2,2-dimethylpropoxy)phenyl]acetaldehyde is CC(C)(C)COc1cc(CC=O)cc(OCC(C)(C)C)c1.
What is the InChIKey of 2-[3,5-bis(2,2-dimethylpropoxy)phenyl]acetaldehyde?
The InChIKey is FGDHWDTXCOXCCI-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H28O3/c1-17(2,3)12-20-15-9-14(7-8-19)10-16(11-15)21-13-18(4,5)6/h8-11H,7,12-13H2,1-6H3.
What are the key properties of 2-[3,5-bis(2,2-dimethylpropoxy)phenyl]acetaldehyde?
2-[3,5-bis(2,2-dimethylpropoxy)phenyl]acetaldehyde has a molecular weight of 292.42 g/mol, XLogP of 4.28, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[3,5-bis(2,2-dimethylpropoxy)phenyl]acetaldehyde is sourced from PubChem (CID 87720248), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).