C10H15N3S — CID 87720920
3-prop-2-ynyl-4,5,6,7-tetrahydro-2H-1,3-benzothiazole-2,6-diamine (PubChem CID 87720920) has the molecular formula C10H15N3S and a molecular weight of 209.32 g/mol. Its IUPAC name is 3-prop-2-ynyl-4,5,6,7-tetrahydro-2H-1,3-benzothiazole-2,6-diamine.
| Compound Name | 3-prop-2-ynyl-4,5,6,7-tetrahydro-2H-1,3-benzothiazole-2,6-diamine |
|---|---|
| PubChem CID | 87720920 |
| Molecular Formula | C10H15N3S |
| Molecular Weight | 209.32 g/mol |
| Exact Mass | 209.10 |
| IUPAC Name | 3-prop-2-ynyl-4,5,6,7-tetrahydro-2H-1,3-benzothiazole-2,6-diamine |
| SMILES | C#CCN1C2=C(CC(N)CC2)SC1N |
| InChI | InChI=1S/C10H15N3S/c1-2-5-13-8-4-3-7(11)6-9(8)14-10(13)12/h1,7,10H,3-6,11-12H2 |
| InChIKey | CGPIGQPPIALTLU-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 55.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.32 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|