About CID 87721465
CID 87721465 (PubChem CID 87721465) has the molecular formula C11H13O2Si
and a molecular weight of 205.31 g/mol.
Molecular Properties
| Compound Name | CID 87721465 |
| PubChem CID | 87721465 |
| Molecular Formula | C11H13O2Si |
| Molecular Weight | 205.31 g/mol |
| Exact Mass | 205.07 |
| IUPAC Name | — |
| SMILES | Cc1cc(C(=O)O)c(C)c(C)c1C[Si] |
| InChI | InChI=1S/C11H13O2Si/c1-6-4-9(11(12)13)7(2)8(3)10(6)5-14/h4H,5H2,1-3H3,(H,12,13) |
| InChIKey | SJYBDJJPNMUQDM-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.31 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 87721465 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 87721465?
The IUPAC name of CID 87721465 (CID 87721465) is not available.
What is the SMILES notation for CID 87721465?
The canonical SMILES for CID 87721465 is Cc1cc(C(=O)O)c(C)c(C)c1C[Si].
What is the InChIKey of CID 87721465?
The InChIKey is SJYBDJJPNMUQDM-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13O2Si/c1-6-4-9(11(12)13)7(2)8(3)10(6)5-14/h4H,5H2,1-3H3,(H,12,13).
What are the key properties of CID 87721465?
CID 87721465 has a molecular weight of 205.31 g/mol, XLogP of 1.98, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 87721465 is sourced from PubChem (CID 87721465), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).