C12H21NTi — CID 87721595
N-methanidyl-N-methylmethanamine;1,2,3,5-tetramethylcyclopenta-1,3-diene;titanium(2+) (PubChem CID 87721595) has the molecular formula C12H21NTi and a molecular weight of 227.17 g/mol. Its IUPAC name is N-methanidyl-N-methylmethanamine;1,2,3,5-tetramethylcyclopenta-1,3-diene;titanium(2+).
| Compound Name | N-methanidyl-N-methylmethanamine;1,2,3,5-tetramethylcyclopenta-1,3-diene;titanium(2+) |
|---|---|
| PubChem CID | 87721595 |
| Molecular Formula | C12H21NTi |
| Molecular Weight | 227.17 g/mol |
| Exact Mass | 227.12 |
| IUPAC Name | N-methanidyl-N-methylmethanamine;1,2,3,5-tetramethylcyclopenta-1,3-diene;titanium(2+) |
| SMILES | CC1=[C-]C(C)C(C)=C1C.[CH2-]N(C)C.[Ti+2] |
| InChI | InChI=1S/C9H13.C3H8N.Ti/c1-6-5-7(2)9(4)8(6)3;1-4(2)3;/h6H,1-4H3;1H2,2-3H3;/q2*-1;+2 |
| InChIKey | RSDVSCQBUVVMJR-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.17 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|