C13H17N4O2+ — CID 8772187
[(2S)-1-(4-cyanoanilino)-1-oxopropan-2-yl]-[2-(methylamino)-2-oxoethyl]azanium (PubChem CID 8772187) has the molecular formula C13H17N4O2+ and a molecular weight of 261.31 g/mol. Its IUPAC name is [(2S)-1-(4-cyanoanilino)-1-oxopropan-2-yl]-[2-(methylamino)-2-oxoethyl]azanium.
| Compound Name | [(2S)-1-(4-cyanoanilino)-1-oxopropan-2-yl]-[2-(methylamino)-2-oxoethyl]azanium |
|---|---|
| PubChem CID | 8772187 |
| Molecular Formula | C13H17N4O2+ |
| Molecular Weight | 261.31 g/mol |
| Exact Mass | 261.13 |
| IUPAC Name | [(2S)-1-(4-cyanoanilino)-1-oxopropan-2-yl]-[2-(methylamino)-2-oxoethyl]azanium |
| SMILES | CNC(=O)C[NH2+][C@@H](C)C(=O)Nc1ccc(C#N)cc1 |
| InChI | InChI=1S/C13H16N4O2/c1-9(16-8-12(18)15-2)13(19)17-11-5-3-10(7-14)4-6-11/h3-6,9,16H,8H2,1-2H3,(H,15,18)(H,17,19)/p+1/t9-/m0/s1 |
| InChIKey | SAGJBPXSIOFATA-VIFPVBQESA-O |
| XLogP | -0.81 |
| TPSA | 98.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.31 |
| LogP ≤ 5 | -0.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |