C23H37N3O5S2 — CID 87721956
(6aR,9R,10aR)-9-(methylsulfanylmethyl)-7-propyl-6,6a,8,9,10,10a-hexahydro-4H-indolo[4,3-fg]quinoline;ethyl carbamate;methanesulfonic acid (PubChem CID 87721956) has the molecular formula C23H37N3O5S2 and a molecular weight of 499.70 g/mol. Its IUPAC name is (6aR,9R,10aR)-9-(methylsulfanylmethyl)-7-propyl-6,6a,8,9,10,10a-hexahydro-4H-indolo[4,3-fg]quinoline;ethyl carbamate;methanesulfonic acid.
| Compound Name | (6aR,9R,10aR)-9-(methylsulfanylmethyl)-7-propyl-6,6a,8,9,10,10a-hexahydro-4H-indolo[4,3-fg]quinoline;ethyl carbamate;methanesulfonic acid |
|---|---|
| PubChem CID | 87721956 |
| Molecular Formula | C23H37N3O5S2 |
| Molecular Weight | 499.70 g/mol |
| Exact Mass | 499.22 |
| IUPAC Name | (6aR,9R,10aR)-9-(methylsulfanylmethyl)-7-propyl-6,6a,8,9,10,10a-hexahydro-4H-indolo[4,3-fg]quinoline;ethyl carbamate;methanesulfonic acid |
| SMILES | CCCN1C[C@H](CSC)C[C@@H]2c3cccc4[nH]cc(c34)C[C@H]21.CCOC(N)=O.CS(=O)(=O)O |
| InChI | InChI=1S/C19H26N2S.C3H7NO2.CH4O3S/c1-3-7-21-11-13(12-22-2)8-16-15-5-4-6-17-19(15)14(10-20-17)9-18(16)21;1-2-6-3(4)5;1-5(2,3)4/h4-6,10,13,16,18,20H,3,7-9,11-12H2,1-2H3;2H2,1H3,(H2,4,5);1H3,(H,2,3,4)/t13-,16-,18-;;/m1../s1 |
| InChIKey | ZNDHNMQDHJFSDZ-FHEIFCHMSA-N |
| XLogP | 3.88 |
| TPSA | 125.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.70 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|