About 2-cyclohexyl-4-hydroxy-1,3-benzoxazole-5,7-disulfonyl chloride
2-cyclohexyl-4-hydroxy-1,3-benzoxazole-5,7-disulfonyl chloride (PubChem CID 87722830) has the molecular formula C13H13Cl2NO6S2
and a molecular weight of 414.29 g/mol. Its IUPAC name is 2-cyclohexyl-4-hydroxy-1,3-benzoxazole-5,7-disulfonyl chloride.
Molecular Properties
| Compound Name | 2-cyclohexyl-4-hydroxy-1,3-benzoxazole-5,7-disulfonyl chloride |
| PubChem CID | 87722830 |
| Molecular Formula | C13H13Cl2NO6S2 |
| Molecular Weight | 414.29 g/mol |
| Exact Mass | 412.96 |
| IUPAC Name | 2-cyclohexyl-4-hydroxy-1,3-benzoxazole-5,7-disulfonyl chloride |
| SMILES | O=S(=O)(Cl)c1cc(S(=O)(=O)Cl)c2oc(C3CCCCC3)nc2c1O |
| InChI | InChI=1S/C13H13Cl2NO6S2/c14-23(18,19)8-6-9(24(15,20)21)12-10(11(8)17)16-13(22-12)7-4-2-1-3-5-7/h6-7,17H,1-5H2 |
| InChIKey | SQZDMVVBZDOLEK-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 114.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 414.29 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 2-cyclohexyl-4-hydroxy-1,3-benzoxazole-5,7-disulfonyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyclohexyl-4-hydroxy-1,3-benzoxazole-5,7-disulfonyl chloride?
The IUPAC name of 2-cyclohexyl-4-hydroxy-1,3-benzoxazole-5,7-disulfonyl chloride (CID 87722830) is 2-cyclohexyl-4-hydroxy-1,3-benzoxazole-5,7-disulfonyl chloride.
What is the SMILES notation for 2-cyclohexyl-4-hydroxy-1,3-benzoxazole-5,7-disulfonyl chloride?
The canonical SMILES for 2-cyclohexyl-4-hydroxy-1,3-benzoxazole-5,7-disulfonyl chloride is O=S(=O)(Cl)c1cc(S(=O)(=O)Cl)c2oc(C3CCCCC3)nc2c1O.
What is the InChIKey of 2-cyclohexyl-4-hydroxy-1,3-benzoxazole-5,7-disulfonyl chloride?
The InChIKey is SQZDMVVBZDOLEK-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H13Cl2NO6S2/c14-23(18,19)8-6-9(24(15,20)21)12-10(11(8)17)16-13(22-12)7-4-2-1-3-5-7/h6-7,17H,1-5H2.
What are the key properties of 2-cyclohexyl-4-hydroxy-1,3-benzoxazole-5,7-disulfonyl chloride?
2-cyclohexyl-4-hydroxy-1,3-benzoxazole-5,7-disulfonyl chloride has a molecular weight of 414.29 g/mol, XLogP of 3.44, 3 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyclohexyl-4-hydroxy-1,3-benzoxazole-5,7-disulfonyl chloride is sourced from PubChem (CID 87722830), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).