C18H17F6N3O2 — CID 87722831
1-[3-methylidene-4-[N-methyl-C-(trifluoromethyl)carbonimidoyl]piperazin-1-yl]-4-(2,4,5-trifluorophenyl)butane-1,3-dione (PubChem CID 87722831) has the molecular formula C18H17F6N3O2 and a molecular weight of 421.34 g/mol. Its IUPAC name is 1-[3-methylidene-4-[N-methyl-C-(trifluoromethyl)carbonimidoyl]piperazin-1-yl]-4-(2,4,5-trifluorophenyl)butane-1,3-dione.
| Compound Name | 1-[3-methylidene-4-[N-methyl-C-(trifluoromethyl)carbonimidoyl]piperazin-1-yl]-4-(2,4,5-trifluorophenyl)butane-1,3-dione |
|---|---|
| PubChem CID | 87722831 |
| Molecular Formula | C18H17F6N3O2 |
| Molecular Weight | 421.34 g/mol |
| Exact Mass | 421.12 |
| IUPAC Name | 1-[3-methylidene-4-[N-methyl-C-(trifluoromethyl)carbonimidoyl]piperazin-1-yl]-4-(2,4,5-trifluorophenyl)butane-1,3-dione |
| SMILES | C=C1CN(C(=O)CC(=O)Cc2cc(F)c(F)cc2F)CCN1/C(=N/C)C(F)(F)F |
| InChI | InChI=1S/C18H17F6N3O2/c1-10-9-26(3-4-27(10)17(25-2)18(22,23)24)16(29)7-12(28)5-11-6-14(20)15(21)8-13(11)19/h6,8H,1,3-5,7,9H2,2H3/b25-17+ |
| InChIKey | BOFDHBZDRDQJDM-KOEQRZSOSA-N |
| XLogP | 2.85 |
| TPSA | 52.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.34 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|