C18H18F6N4O — CID 87723059
(Z)-3-amino-1-[3-methylidene-4-[N-methyl-C-(trifluoromethyl)carbonimidoyl]piperazin-1-yl]-4-(2,4,5-trifluorophenyl)but-2-en-1-one (PubChem CID 87723059) has the molecular formula C18H18F6N4O and a molecular weight of 420.36 g/mol. Its IUPAC name is (Z)-3-amino-1-[3-methylidene-4-[N-methyl-C-(trifluoromethyl)carbonimidoyl]piperazin-1-yl]-4-(2,4,5-trifluorophenyl)but-2-en-1-one.
| Compound Name | (Z)-3-amino-1-[3-methylidene-4-[N-methyl-C-(trifluoromethyl)carbonimidoyl]piperazin-1-yl]-4-(2,4,5-trifluorophenyl)but-2-en-1-one |
|---|---|
| PubChem CID | 87723059 |
| Molecular Formula | C18H18F6N4O |
| Molecular Weight | 420.36 g/mol |
| Exact Mass | 420.14 |
| IUPAC Name | (Z)-3-amino-1-[3-methylidene-4-[N-methyl-C-(trifluoromethyl)carbonimidoyl]piperazin-1-yl]-4-(2,4,5-trifluorophenyl)but-2-en-1-one |
| SMILES | C=C1CN(C(=O)/C=C(\N)Cc2cc(F)c(F)cc2F)CCN1/C(=N/C)C(F)(F)F |
| InChI | InChI=1S/C18H18F6N4O/c1-10-9-27(3-4-28(10)17(26-2)18(22,23)24)16(29)7-12(25)5-11-6-14(20)15(21)8-13(11)19/h6-8H,1,3-5,9,25H2,2H3/b12-7-,26-17+ |
| InChIKey | GRJMNPVARKGCID-BUDUFCALSA-N |
| XLogP | 2.74 |
| TPSA | 61.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.36 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|