C21H30FNO3 — CID 87723095
3-[(3S,5R)-4-(3-fluoro-2-methylphenyl)-3-(2-methoxyethyl)-5-propanoylpiperidin-3-yl]propanal (PubChem CID 87723095) has the molecular formula C21H30FNO3 and a molecular weight of 363.47 g/mol. Its IUPAC name is 3-[(3S,5R)-4-(3-fluoro-2-methylphenyl)-3-(2-methoxyethyl)-5-propanoylpiperidin-3-yl]propanal.
| Compound Name | 3-[(3S,5R)-4-(3-fluoro-2-methylphenyl)-3-(2-methoxyethyl)-5-propanoylpiperidin-3-yl]propanal |
|---|---|
| PubChem CID | 87723095 |
| Molecular Formula | C21H30FNO3 |
| Molecular Weight | 363.47 g/mol |
| Exact Mass | 363.22 |
| IUPAC Name | 3-[(3S,5R)-4-(3-fluoro-2-methylphenyl)-3-(2-methoxyethyl)-5-propanoylpiperidin-3-yl]propanal |
| SMILES | CCC(=O)[C@H]1CNC[C@@](CCC=O)(CCOC)C1c1cccc(F)c1C |
| InChI | InChI=1S/C21H30FNO3/c1-4-19(25)17-13-23-14-21(9-6-11-24,10-12-26-3)20(17)16-7-5-8-18(22)15(16)2/h5,7-8,11,17,20,23H,4,6,9-10,12-14H2,1-3H3/t17-,20?,21-/m1/s1 |
| InChIKey | ALGHCJXHLDQJGK-UBCDJDFNSA-N |
| XLogP | 3.42 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.47 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|