C12H9F6N3 — CID 87723682
[4-[3,5-bis(trifluoromethyl)pyrazol-1-yl]phenyl]methanamine (PubChem CID 87723682) has the molecular formula C12H9F6N3 and a molecular weight of 309.21 g/mol. Its IUPAC name is [4-[3,5-bis(trifluoromethyl)pyrazol-1-yl]phenyl]methanamine.
| Compound Name | [4-[3,5-bis(trifluoromethyl)pyrazol-1-yl]phenyl]methanamine |
|---|---|
| PubChem CID | 87723682 |
| Molecular Formula | C12H9F6N3 |
| Molecular Weight | 309.21 g/mol |
| Exact Mass | 309.07 |
| IUPAC Name | [4-[3,5-bis(trifluoromethyl)pyrazol-1-yl]phenyl]methanamine |
| SMILES | NCc1ccc(-n2nc(C(F)(F)F)cc2C(F)(F)F)cc1 |
| InChI | InChI=1S/C12H9F6N3/c13-11(14,15)9-5-10(12(16,17)18)21(20-9)8-3-1-7(6-19)2-4-8/h1-5H,6,19H2 |
| InChIKey | CCFDUUKPEJWYGF-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.21 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |