C21H27ClN6 — CID 87723709
1-[4-[4-(6-chloropyridazin-3-yl)piperazin-1-yl]phenyl]-5-methyl-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrole (PubChem CID 87723709) has the molecular formula C21H27ClN6 and a molecular weight of 398.94 g/mol. Its IUPAC name is 1-[4-[4-(6-chloropyridazin-3-yl)piperazin-1-yl]phenyl]-5-methyl-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrole.
| Compound Name | 1-[4-[4-(6-chloropyridazin-3-yl)piperazin-1-yl]phenyl]-5-methyl-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrole |
|---|---|
| PubChem CID | 87723709 |
| Molecular Formula | C21H27ClN6 |
| Molecular Weight | 398.94 g/mol |
| Exact Mass | 398.20 |
| IUPAC Name | 1-[4-[4-(6-chloropyridazin-3-yl)piperazin-1-yl]phenyl]-5-methyl-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrole |
| SMILES | CN1CC2CCN(c3ccc(N4CCN(c5ccc(Cl)nn5)CC4)cc3)C2C1 |
| InChI | InChI=1S/C21H27ClN6/c1-25-14-16-8-9-28(19(16)15-25)18-4-2-17(3-5-18)26-10-12-27(13-11-26)21-7-6-20(22)23-24-21/h2-7,16,19H,8-15H2,1H3 |
| InChIKey | UPILQXMDPFUTJP-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 38.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.94 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|