C18H18N4O4 — CID 87723952
2-(2,4-diaminoquinazolin-6-yl)-3,5-dimethoxy-4-methylbenzoic acid (PubChem CID 87723952) has the molecular formula C18H18N4O4 and a molecular weight of 354.37 g/mol. Its IUPAC name is 2-(2,4-diaminoquinazolin-6-yl)-3,5-dimethoxy-4-methylbenzoic acid.
| Compound Name | 2-(2,4-diaminoquinazolin-6-yl)-3,5-dimethoxy-4-methylbenzoic acid |
|---|---|
| PubChem CID | 87723952 |
| Molecular Formula | C18H18N4O4 |
| Molecular Weight | 354.37 g/mol |
| Exact Mass | 354.13 |
| IUPAC Name | 2-(2,4-diaminoquinazolin-6-yl)-3,5-dimethoxy-4-methylbenzoic acid |
| SMILES | COc1cc(C(=O)O)c(-c2ccc3nc(N)nc(N)c3c2)c(OC)c1C |
| InChI | InChI=1S/C18H18N4O4/c1-8-13(25-2)7-11(17(23)24)14(15(8)26-3)9-4-5-12-10(6-9)16(19)22-18(20)21-12/h4-7H,1-3H3,(H,23,24)(H4,19,20,21,22) |
| InChIKey | FQBRXCQQRPVGFG-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 133.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.37 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |