C8H7N3O — CID 87724480
(7Z)-9H-pyrimido[4,5-b][1,5]oxazocine (PubChem CID 87724480) has the molecular formula C8H7N3O and a molecular weight of 161.16 g/mol. Its IUPAC name is (7Z)-9H-pyrimido[4,5-b][1,5]oxazocine.
| Compound Name | (7Z)-9H-pyrimido[4,5-b][1,5]oxazocine |
|---|---|
| PubChem CID | 87724480 |
| Molecular Formula | C8H7N3O |
| Molecular Weight | 161.16 g/mol |
| Exact Mass | 161.06 |
| IUPAC Name | (7Z)-9H-pyrimido[4,5-b][1,5]oxazocine |
| SMILES | C1=C\N=C/c2cncnc2OC/1 |
| InChI | InChI=1S/C8H7N3O/c1-2-9-4-7-5-10-6-11-8(7)12-3-1/h1-2,4-6H,3H2/b2-1-,9-4- |
| InChIKey | QESDAISWQPGRPL-PYXIRFKBSA-N |
| XLogP | 0.80 |
| TPSA | 47.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 161.16 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |