About 4-[(2,6-dichloro-4-phenylmethoxyphenoxy)methyl]-1-formylpiperidine-2-carboxylic acid
4-[(2,6-dichloro-4-phenylmethoxyphenoxy)methyl]-1-formylpiperidine-2-carboxylic acid (PubChem CID 87724664) has the molecular formula C21H21Cl2NO5
and a molecular weight of 438.31 g/mol. Its IUPAC name is 4-[(2,6-dichloro-4-phenylmethoxyphenoxy)methyl]-1-formylpiperidine-2-carboxylic acid.
Molecular Properties
| Compound Name | 4-[(2,6-dichloro-4-phenylmethoxyphenoxy)methyl]-1-formylpiperidine-2-carboxylic acid |
| PubChem CID | 87724664 |
| Molecular Formula | C21H21Cl2NO5 |
| Molecular Weight | 438.31 g/mol |
| Exact Mass | 437.08 |
| IUPAC Name | 4-[(2,6-dichloro-4-phenylmethoxyphenoxy)methyl]-1-formylpiperidine-2-carboxylic acid |
| SMILES | O=CN1CCC(COc2c(Cl)cc(OCc3ccccc3)cc2Cl)CC1C(=O)O |
| InChI | InChI=1S/C21H21Cl2NO5/c22-17-9-16(28-11-14-4-2-1-3-5-14)10-18(23)20(17)29-12-15-6-7-24(13-25)19(8-15)21(26)27/h1-5,9-10,13,15,19H,6-8,11-12H2,(H,26,27) |
| InChIKey | AGGWLAXAKXQRNW-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 438.31 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 4-[(2,6-dichloro-4-phenylmethoxyphenoxy)methyl]-1-formylpiperidine-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(2,6-dichloro-4-phenylmethoxyphenoxy)methyl]-1-formylpiperidine-2-carboxylic acid?
The IUPAC name of 4-[(2,6-dichloro-4-phenylmethoxyphenoxy)methyl]-1-formylpiperidine-2-carboxylic acid (CID 87724664) is 4-[(2,6-dichloro-4-phenylmethoxyphenoxy)methyl]-1-formylpiperidine-2-carboxylic acid.
What is the SMILES notation for 4-[(2,6-dichloro-4-phenylmethoxyphenoxy)methyl]-1-formylpiperidine-2-carboxylic acid?
The canonical SMILES for 4-[(2,6-dichloro-4-phenylmethoxyphenoxy)methyl]-1-formylpiperidine-2-carboxylic acid is O=CN1CCC(COc2c(Cl)cc(OCc3ccccc3)cc2Cl)CC1C(=O)O.
What is the InChIKey of 4-[(2,6-dichloro-4-phenylmethoxyphenoxy)methyl]-1-formylpiperidine-2-carboxylic acid?
The InChIKey is AGGWLAXAKXQRNW-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H21Cl2NO5/c22-17-9-16(28-11-14-4-2-1-3-5-14)10-18(23)20(17)29-12-15-6-7-24(13-25)19(8-15)21(26)27/h1-5,9-10,13,15,19H,6-8,11-12H2,(H,26,27).
What are the key properties of 4-[(2,6-dichloro-4-phenylmethoxyphenoxy)methyl]-1-formylpiperidine-2-carboxylic acid?
4-[(2,6-dichloro-4-phenylmethoxyphenoxy)methyl]-1-formylpiperidine-2-carboxylic acid has a molecular weight of 438.31 g/mol, XLogP of 4.27, 8 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(2,6-dichloro-4-phenylmethoxyphenoxy)methyl]-1-formylpiperidine-2-carboxylic acid is sourced from PubChem (CID 87724664), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).