About CID 87725639
CID 87725639 (PubChem CID 87725639) has the molecular formula C23H34InN3
and a molecular weight of 467.36 g/mol.
Molecular Properties
| Compound Name | CID 87725639 |
| PubChem CID | 87725639 |
| Molecular Formula | C23H34InN3 |
| Molecular Weight | 467.36 g/mol |
| Exact Mass | 467.18 |
| IUPAC Name | — |
| SMILES | CCCCC(CCC[In])c1cc2ccccc2c(N2CCN(CC)CC2)n1 |
| InChI | InChI=1S/C23H34N3.In/c1-4-7-11-19(10-5-2)22-18-20-12-8-9-13-21(20)23(24-22)26-16-14-25(6-3)15-17-26;/h8-9,12-13,18-19H,2,4-7,10-11,14-17H2,1,3H3; |
| InChIKey | MGPLTRMPPOJZFX-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 19.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 467.36 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze CID 87725639 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 87725639?
The IUPAC name of CID 87725639 (CID 87725639) is not available.
What is the SMILES notation for CID 87725639?
The canonical SMILES for CID 87725639 is CCCCC(CCC[In])c1cc2ccccc2c(N2CCN(CC)CC2)n1.
What is the InChIKey of CID 87725639?
The InChIKey is MGPLTRMPPOJZFX-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H34N3.In/c1-4-7-11-19(10-5-2)22-18-20-12-8-9-13-21(20)23(24-22)26-16-14-25(6-3)15-17-26;/h8-9,12-13,18-19H,2,4-7,10-11,14-17H2,1,3H3;.
What are the key properties of CID 87725639?
CID 87725639 has a molecular weight of 467.36 g/mol, XLogP of 5.02, 9 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 87725639 is sourced from PubChem (CID 87725639), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).