C34H49N4O5S+ — CID 87725955
[(2S)-1-amino-3-methyl-1-oxobutan-2-yl]-[[4-[2-[(4,5-dimethyl-1,2-oxazol-3-yl)sulfamoyl]phenyl]phenyl]methyl]-hexyl-pentanoylazanium (PubChem CID 87725955) has the molecular formula C34H49N4O5S+ and a molecular weight of 625.86 g/mol. Its IUPAC name is [(2S)-1-amino-3-methyl-1-oxobutan-2-yl]-[[4-[2-[(4,5-dimethyl-1,2-oxazol-3-yl)sulfamoyl]phenyl]phenyl]methyl]-hexyl-pentanoylazanium.
| Compound Name | [(2S)-1-amino-3-methyl-1-oxobutan-2-yl]-[[4-[2-[(4,5-dimethyl-1,2-oxazol-3-yl)sulfamoyl]phenyl]phenyl]methyl]-hexyl-pentanoylazanium |
|---|---|
| PubChem CID | 87725955 |
| Molecular Formula | C34H49N4O5S+ |
| Molecular Weight | 625.86 g/mol |
| Exact Mass | 625.34 |
| IUPAC Name | [(2S)-1-amino-3-methyl-1-oxobutan-2-yl]-[[4-[2-[(4,5-dimethyl-1,2-oxazol-3-yl)sulfamoyl]phenyl]phenyl]methyl]-hexyl-pentanoylazanium |
| SMILES | CCCCCC[N+](Cc1ccc(-c2ccccc2S(=O)(=O)Nc2noc(C)c2C)cc1)(C(=O)CCCC)[C@H](C(N)=O)C(C)C |
| InChI | InChI=1S/C34H48N4O5S/c1-7-9-11-14-22-38(31(39)17-10-8-2,32(24(3)4)33(35)40)23-27-18-20-28(21-19-27)29-15-12-13-16-30(29)44(41,42)37-34-25(5)26(6)43-36-34/h12-13,15-16,18-21,24,32H,7-11,14,17,22-23H2,1-6H3,(H2-,35,36,37,40)/p+1/t32-,38?/m0/s1 |
| InChIKey | UXCZETFZGSTUDD-MDYKADOQSA-O |
| XLogP | 6.88 |
| TPSA | 132.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.86 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|