C18H26N2O3 — CID 87726747
N-[9-[1-(4-methoxy-2,3-dimethylphenyl)ethyl]-3-oxa-9-azabicyclo[3.3.1]nonan-7-ylidene]hydroxylamine (PubChem CID 87726747) has the molecular formula C18H26N2O3 and a molecular weight of 318.42 g/mol. Its IUPAC name is N-[9-[1-(4-methoxy-2,3-dimethylphenyl)ethyl]-3-oxa-9-azabicyclo[3.3.1]nonan-7-ylidene]hydroxylamine.
| Compound Name | N-[9-[1-(4-methoxy-2,3-dimethylphenyl)ethyl]-3-oxa-9-azabicyclo[3.3.1]nonan-7-ylidene]hydroxylamine |
|---|---|
| PubChem CID | 87726747 |
| Molecular Formula | C18H26N2O3 |
| Molecular Weight | 318.42 g/mol |
| Exact Mass | 318.19 |
| IUPAC Name | N-[9-[1-(4-methoxy-2,3-dimethylphenyl)ethyl]-3-oxa-9-azabicyclo[3.3.1]nonan-7-ylidene]hydroxylamine |
| SMILES | COc1ccc(C(C)N2C3COCC2CC(=NO)C3)c(C)c1C |
| InChI | InChI=1S/C18H26N2O3/c1-11-12(2)18(22-4)6-5-17(11)13(3)20-15-7-14(19-21)8-16(20)10-23-9-15/h5-6,13,15-16,21H,7-10H2,1-4H3 |
| InChIKey | USICXNGIBRQJIS-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 54.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.42 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|