C23H26BrN3O3S2 — CID 87727028
[5-[hydroxy(dithiophen-2-yl)methyl]-1,3,4-oxadiazol-2-yl]methyl-dimethyl-(3-phenoxypropyl)azanium bromide (PubChem CID 87727028) has the molecular formula C23H26BrN3O3S2 and a molecular weight of 536.52 g/mol. Its IUPAC name is [5-[hydroxy(dithiophen-2-yl)methyl]-1,3,4-oxadiazol-2-yl]methyl-dimethyl-(3-phenoxypropyl)azanium bromide.
| Compound Name | [5-[hydroxy(dithiophen-2-yl)methyl]-1,3,4-oxadiazol-2-yl]methyl-dimethyl-(3-phenoxypropyl)azanium bromide |
|---|---|
| PubChem CID | 87727028 |
| Molecular Formula | C23H26BrN3O3S2 |
| Molecular Weight | 536.52 g/mol |
| Exact Mass | 535.06 |
| IUPAC Name | [5-[hydroxy(dithiophen-2-yl)methyl]-1,3,4-oxadiazol-2-yl]methyl-dimethyl-(3-phenoxypropyl)azanium bromide |
| SMILES | C[N+](C)(CCCOc1ccccc1)Cc1nnc(C(O)(c2cccs2)c2cccs2)o1.[Br-] |
| InChI | InChI=1S/C23H26N3O3S2.BrH/c1-26(2,13-8-14-28-18-9-4-3-5-10-18)17-21-24-25-22(29-21)23(27,19-11-6-15-30-19)20-12-7-16-31-20;/h3-7,9-12,15-16,27H,8,13-14,17H2,1-2H3;1H/q+1;/p-1 |
| InChIKey | JDRRSBOFDLDNSV-UHFFFAOYSA-M |
| XLogP | 1.53 |
| TPSA | 68.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.52 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|