C57H64Cl2F2N8O6 — CID 87727074
2,3-bis[3-[[4-(2-chloro-6-fluorophenyl)piperidin-1-yl]methyl]-2-(morpholine-4-carbonyl)indol-1-yl]-N,N,N'-trimethylbutanediamide (PubChem CID 87727074) has the molecular formula C57H64Cl2F2N8O6 and a molecular weight of 1066.09 g/mol. Its IUPAC name is 2,3-bis[3-[[4-(2-chloro-6-fluorophenyl)piperidin-1-yl]methyl]-2-(morpholine-4-carbonyl)indol-1-yl]-N,N,N'-trimethylbutanediamide.
| Compound Name | 2,3-bis[3-[[4-(2-chloro-6-fluorophenyl)piperidin-1-yl]methyl]-2-(morpholine-4-carbonyl)indol-1-yl]-N,N,N'-trimethylbutanediamide |
|---|---|
| PubChem CID | 87727074 |
| Molecular Formula | C57H64Cl2F2N8O6 |
| Molecular Weight | 1066.09 g/mol |
| Exact Mass | 1064.43 |
| IUPAC Name | 2,3-bis[3-[[4-(2-chloro-6-fluorophenyl)piperidin-1-yl]methyl]-2-(morpholine-4-carbonyl)indol-1-yl]-N,N,N'-trimethylbutanediamide |
| SMILES | CNC(=O)C(C(C(=O)N(C)C)n1c(C(=O)N2CCOCC2)c(CN2CCC(c3c(F)cccc3Cl)CC2)c2ccccc21)n1c(C(=O)N2CCOCC2)c(CN2CCC(c3c(F)cccc3Cl)CC2)c2ccccc21 |
| InChI | InChI=1S/C57H64Cl2F2N8O6/c1-62-54(70)52(68-46-16-6-4-10-38(46)40(50(68)56(72)66-26-30-74-31-27-66)34-64-22-18-36(19-23-64)48-42(58)12-8-14-44(48)60)53(55(71)63(2)3)69-47-17-7-5-11-39(47)41(51(69)57(73)67-28-32-75-33-29-67)35-65-24-20-37(21-25-65)49-43(59)13-9-15-45(49)61/h4-17,36-37,52-53H,18-35H2,1-3H3,(H,62,70) |
| InChIKey | JLYULUAVQBGSMZ-UHFFFAOYSA-N |
| XLogP | 8.50 |
| TPSA | 124.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 75 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1066.09 |
| LogP ≤ 5 | 8.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |