C28H21Cl2N5O3S — CID 87727160
1-[(2S)-1-(2,4-dichlorophenyl)-3-(1,3-dioxoisoindol-2-yl)propan-2-yl]-3-(isoquinoline-6-carbonylamino)thiourea (PubChem CID 87727160) has the molecular formula C28H21Cl2N5O3S and a molecular weight of 578.48 g/mol. Its IUPAC name is 1-[(2S)-1-(2,4-dichlorophenyl)-3-(1,3-dioxoisoindol-2-yl)propan-2-yl]-3-(isoquinoline-6-carbonylamino)thiourea.
| Compound Name | 1-[(2S)-1-(2,4-dichlorophenyl)-3-(1,3-dioxoisoindol-2-yl)propan-2-yl]-3-(isoquinoline-6-carbonylamino)thiourea |
|---|---|
| PubChem CID | 87727160 |
| Molecular Formula | C28H21Cl2N5O3S |
| Molecular Weight | 578.48 g/mol |
| Exact Mass | 577.07 |
| IUPAC Name | 1-[(2S)-1-(2,4-dichlorophenyl)-3-(1,3-dioxoisoindol-2-yl)propan-2-yl]-3-(isoquinoline-6-carbonylamino)thiourea |
| SMILES | O=C(NNC(=S)N[C@@H](Cc1ccc(Cl)cc1Cl)CN1C(=O)c2ccccc2C1=O)c1ccc2cnccc2c1 |
| InChI | InChI=1S/C28H21Cl2N5O3S/c29-20-8-7-17(24(30)13-20)12-21(15-35-26(37)22-3-1-2-4-23(22)27(35)38)32-28(39)34-33-25(36)18-5-6-19-14-31-10-9-16(19)11-18/h1-11,13-14,21H,12,15H2,(H,33,36)(H2,32,34,39)/t21-/m0/s1 |
| InChIKey | KKVZVDLGGQDHKH-NRFANRHFSA-N |
| XLogP | 4.56 |
| TPSA | 103.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.48 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|