About naphthalene-1,4-dione;thiopyrylium
naphthalene-1,4-dione;thiopyrylium (PubChem CID 87727819) has the molecular formula C15H11O2S+
and a molecular weight of 255.32 g/mol. Its IUPAC name is naphthalene-1,4-dione;thiopyrylium.
Molecular Properties
| Compound Name | naphthalene-1,4-dione;thiopyrylium |
| PubChem CID | 87727819 |
| Molecular Formula | C15H11O2S+ |
| Molecular Weight | 255.32 g/mol |
| Exact Mass | 255.05 |
| IUPAC Name | naphthalene-1,4-dione;thiopyrylium |
| SMILES | O=C1C=CC(=O)c2ccccc21.c1cc[s+]cc1 |
| InChI | InChI=1S/C10H6O2.C5H5S/c11-9-5-6-10(12)8-4-2-1-3-7(8)9;1-2-4-6-5-3-1/h1-6H;1-5H/q;+1 |
| InChIKey | XOIIZTSYGKAPQE-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.32 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|
Analyze naphthalene-1,4-dione;thiopyrylium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of naphthalene-1,4-dione;thiopyrylium?
The IUPAC name of naphthalene-1,4-dione;thiopyrylium (CID 87727819) is naphthalene-1,4-dione;thiopyrylium.
What is the SMILES notation for naphthalene-1,4-dione;thiopyrylium?
The canonical SMILES for naphthalene-1,4-dione;thiopyrylium is O=C1C=CC(=O)c2ccccc21.c1cc[s+]cc1.
What is the InChIKey of naphthalene-1,4-dione;thiopyrylium?
The InChIKey is XOIIZTSYGKAPQE-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H6O2.C5H5S/c11-9-5-6-10(12)8-4-2-1-3-7(8)9;1-2-4-6-5-3-1/h1-6H;1-5H/q;+1.
What are the key properties of naphthalene-1,4-dione;thiopyrylium?
naphthalene-1,4-dione;thiopyrylium has a molecular weight of 255.32 g/mol, XLogP of 3.65, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for naphthalene-1,4-dione;thiopyrylium is sourced from PubChem (CID 87727819), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).