C18H11BrF5N3O3 — CID 87728046
2-amino-5-(3-bromo-4-fluorophenyl)-3-methyl-5-(2,2,3,3-tetrafluoro-1,4-benzodioxin-6-yl)imidazol-4-one (PubChem CID 87728046) has the molecular formula C18H11BrF5N3O3 and a molecular weight of 492.20 g/mol. Its IUPAC name is 2-amino-5-(3-bromo-4-fluorophenyl)-3-methyl-5-(2,2,3,3-tetrafluoro-1,4-benzodioxin-6-yl)imidazol-4-one.
| Compound Name | 2-amino-5-(3-bromo-4-fluorophenyl)-3-methyl-5-(2,2,3,3-tetrafluoro-1,4-benzodioxin-6-yl)imidazol-4-one |
|---|---|
| PubChem CID | 87728046 |
| Molecular Formula | C18H11BrF5N3O3 |
| Molecular Weight | 492.20 g/mol |
| Exact Mass | 490.99 |
| IUPAC Name | 2-amino-5-(3-bromo-4-fluorophenyl)-3-methyl-5-(2,2,3,3-tetrafluoro-1,4-benzodioxin-6-yl)imidazol-4-one |
| SMILES | CN1C(=O)C(c2ccc(F)c(Br)c2)(c2ccc3c(c2)OC(F)(F)C(F)(F)O3)N=C1N |
| InChI | InChI=1S/C18H11BrF5N3O3/c1-27-14(28)16(26-15(27)25,8-2-4-11(20)10(19)6-8)9-3-5-12-13(7-9)30-18(23,24)17(21,22)29-12/h2-7H,1H3,(H2,25,26) |
| InChIKey | JOECCTARGXLOQV-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 77.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.20 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|