About 3-methyl-2-propan-2-ylbutan-1-amine;sulfur monoxide
3-methyl-2-propan-2-ylbutan-1-amine;sulfur monoxide (PubChem CID 87728536) has the molecular formula C8H19NOS
and a molecular weight of 177.31 g/mol. Its IUPAC name is 3-methyl-2-propan-2-ylbutan-1-amine;sulfur monoxide.
Molecular Properties
| Compound Name | 3-methyl-2-propan-2-ylbutan-1-amine;sulfur monoxide |
| PubChem CID | 87728536 |
| Molecular Formula | C8H19NOS |
| Molecular Weight | 177.31 g/mol |
| Exact Mass | 177.12 |
| IUPAC Name | 3-methyl-2-propan-2-ylbutan-1-amine;sulfur monoxide |
| SMILES | CC(C)C(CN)C(C)C.O=S |
| InChI | InChI=1S/C8H19N.OS/c1-6(2)8(5-9)7(3)4;1-2/h6-8H,5,9H2,1-4H3; |
| InChIKey | SBKGWZSFWWNVAF-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 177.31 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-methyl-2-propan-2-ylbutan-1-amine;sulfur monoxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methyl-2-propan-2-ylbutan-1-amine;sulfur monoxide?
The IUPAC name of 3-methyl-2-propan-2-ylbutan-1-amine;sulfur monoxide (CID 87728536) is 3-methyl-2-propan-2-ylbutan-1-amine;sulfur monoxide.
What is the SMILES notation for 3-methyl-2-propan-2-ylbutan-1-amine;sulfur monoxide?
The canonical SMILES for 3-methyl-2-propan-2-ylbutan-1-amine;sulfur monoxide is CC(C)C(CN)C(C)C.O=S.
What is the InChIKey of 3-methyl-2-propan-2-ylbutan-1-amine;sulfur monoxide?
The InChIKey is SBKGWZSFWWNVAF-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H19N.OS/c1-6(2)8(5-9)7(3)4;1-2/h6-8H,5,9H2,1-4H3;.
What are the key properties of 3-methyl-2-propan-2-ylbutan-1-amine;sulfur monoxide?
3-methyl-2-propan-2-ylbutan-1-amine;sulfur monoxide has a molecular weight of 177.31 g/mol, XLogP of 1.54, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyl-2-propan-2-ylbutan-1-amine;sulfur monoxide is sourced from PubChem (CID 87728536), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).