About guanidine;methylsulfonyl 2-(3-fluorophenyl)-5-methyl-1H-imidazole-4-carboxylate
guanidine;methylsulfonyl 2-(3-fluorophenyl)-5-methyl-1H-imidazole-4-carboxylate (PubChem CID 87728562) has the molecular formula C13H16FN5O4S
and a molecular weight of 357.37 g/mol. Its IUPAC name is guanidine;methylsulfonyl 2-(3-fluorophenyl)-5-methyl-1H-imidazole-4-carboxylate.
Molecular Properties
| Compound Name | guanidine;methylsulfonyl 2-(3-fluorophenyl)-5-methyl-1H-imidazole-4-carboxylate |
| PubChem CID | 87728562 |
| Molecular Formula | C13H16FN5O4S |
| Molecular Weight | 357.37 g/mol |
| Exact Mass | 357.09 |
| IUPAC Name | guanidine;methylsulfonyl 2-(3-fluorophenyl)-5-methyl-1H-imidazole-4-carboxylate |
| SMILES | Cc1[nH]c(-c2cccc(F)c2)nc1C(=O)OS(C)(=O)=O.[H]N=C(N)N |
| InChI | InChI=1S/C12H11FN2O4S.CH5N3/c1-7-10(12(16)19-20(2,17)18)15-11(14-7)8-4-3-5-9(13)6-8;2-1(3)4/h3-6H,1-2H3,(H,14,15);(H5,2,3,4) |
| InChIKey | SCGXRLWGJQCDRY-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 165.01 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 357.37 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze guanidine;methylsulfonyl 2-(3-fluorophenyl)-5-methyl-1H-imidazole-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of guanidine;methylsulfonyl 2-(3-fluorophenyl)-5-methyl-1H-imidazole-4-carboxylate?
The IUPAC name of guanidine;methylsulfonyl 2-(3-fluorophenyl)-5-methyl-1H-imidazole-4-carboxylate (CID 87728562) is guanidine;methylsulfonyl 2-(3-fluorophenyl)-5-methyl-1H-imidazole-4-carboxylate.
What is the SMILES notation for guanidine;methylsulfonyl 2-(3-fluorophenyl)-5-methyl-1H-imidazole-4-carboxylate?
The canonical SMILES for guanidine;methylsulfonyl 2-(3-fluorophenyl)-5-methyl-1H-imidazole-4-carboxylate is Cc1[nH]c(-c2cccc(F)c2)nc1C(=O)OS(C)(=O)=O.[H]N=C(N)N.
What is the InChIKey of guanidine;methylsulfonyl 2-(3-fluorophenyl)-5-methyl-1H-imidazole-4-carboxylate?
The InChIKey is SCGXRLWGJQCDRY-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11FN2O4S.CH5N3/c1-7-10(12(16)19-20(2,17)18)15-11(14-7)8-4-3-5-9(13)6-8;2-1(3)4/h3-6H,1-2H3,(H,14,15);(H5,2,3,4).
What are the key properties of guanidine;methylsulfonyl 2-(3-fluorophenyl)-5-methyl-1H-imidazole-4-carboxylate?
guanidine;methylsulfonyl 2-(3-fluorophenyl)-5-methyl-1H-imidazole-4-carboxylate has a molecular weight of 357.37 g/mol, XLogP of 0.48, 3 rotatable bonds, 4 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for guanidine;methylsulfonyl 2-(3-fluorophenyl)-5-methyl-1H-imidazole-4-carboxylate is sourced from PubChem (CID 87728562), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).